1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene
1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene structure
|
Common Name | 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 60082-97-5 | Molecular Weight | 356.45900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene, with CAS number 60082-97-5, molecular formula C13H7Cl5O, and molecular weight 356.46. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7Cl5O |
|---|---|
| Molecular Weight | 356.45900 |
| Exact Mass | 353.89400 |
| PSA | 9.23000 |
| LogP | 6.62920 |
| InChIKey | YEVLZBGKWIOXOL-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)cc(-c2cc(Cl)c(Cl)cc2Cl)c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,2,4-trichloro... CAS#:60082-97-5
Detail
Learn More
|
| Literature: Mannila, Erkki; Kolehmainen, Erkki; Rissanen, Kari Acta Chemica Scandinavica, 1994 , vol. 48, # 8 p. 684 - 688 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Methoxy-2,5,2',4',5'-pentachlorobiphenyl |
| 3'-methoxy-2,2',4,5,5'-pentachlorobiphenyl |
| 1,1'-Biphenyl,2,2',4',5,5'-pentachloro-3-methoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 60082-97-5? |
| A: Chinese name of 60082-97-5 is 60082-97-5. |
| Q: What English synonyms does 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene have? |
| A: English synonyms of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene: 3-Methoxy-2,5,2',4',5'-pentachlorobiphenyl, 3'-methoxy-2,2',4,5,5'-pentachlorobiphenyl, 1,1'-Biphenyl,2,2',4',5,5'-pentachloro-3-methoxy. |
| Q: What is the LogP of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: LogP of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is 6.62920. |
| Q: What is the InChIKey of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: InChIKey of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is YEVLZBGKWIOXOL-UHFFFAOYSA-N. |
| Q: What is the English name of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: The English name of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene. |
| Q: What is the polar surface area (PSA) of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: Polar surface area (PSA) of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is 9.23000. |
| Q: What is the molecular weight of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: Molecular weight of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is 356.45900. |
| Q: What is the SMILES notation of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: SMILES notation of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is COc1cc(Cl)cc(-c2cc(Cl)c(Cl)cc2Cl)c1Cl. |
| Q: What is the CAS number of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: CAS number of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is 60082-97-5. |
| Q: What is the molecular formula of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene? |
| A: Molecular formula of 1,2,4-trichloro-5-(2,5-dichloro-3-methoxyphenyl)benzene is C13H7Cl5O. |