2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide
![2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide Structure](https://image.chemsrc.com/caspic/086/60084-08-4.png)
2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide structure
|
Common Name | 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 60084-08-4 | Molecular Weight | 267.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9N3O4S |
|---|---|
| Molecular Weight | 267.26100 |
| Exact Mass | 267.03100 |
| PSA | 162.66000 |
| LogP | 1.86160 |
| InChIKey | ACXXNGXTDXTNRI-UHFFFAOYSA-N |
| SMILES | NC(=O)c1nc(-c2ccc(CO)o2)sc1C(N)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[5-(hydroxyme... CAS#:60084-08-4 |
| Literature: Fuertes; Garcia Lopez; Garcia Munoz; Stud Journal of Organic Chemistry, 1976 , vol. 41, # 26 p. 4074 - 4077 |
|
~%
2-[5-(hydroxyme... CAS#:60084-08-4 |
| Literature: Fuertes; Garcia Lopez; Garcia Munoz; Stud Journal of Organic Chemistry, 1976 , vol. 41, # 26 p. 4074 - 4077 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,5-Thiazoledicarboxamide,2-[5-(hydroxymethyl)-2-furanyl] |
| 2-(5-hydroxymethyl-furan-2-yl)-thiazole-4,5-dicarboxylic acid diamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide have? |
| A: English synonyms of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide: 4,5-Thiazoledicarboxamide,2-[5-(hydroxymethyl)-2-furanyl], 2-(5-hydroxymethyl-furan-2-yl)-thiazole-4,5-dicarboxylic acid diamide. |
| Q: What is the molecular weight of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: Molecular weight of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is 267.26100. |
| Q: What is the molecular formula of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: Molecular formula of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is C10H9N3O4S. |
| Q: What is the English name of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: The English name of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide. |
| Q: What is the InChIKey of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: InChIKey of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is ACXXNGXTDXTNRI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 60084-08-4? |
| A: Chinese name of 60084-08-4 is 60084-08-4. |
| Q: What is the SMILES notation of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: SMILES notation of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is NC(=O)c1nc(-c2ccc(CO)o2)sc1C(N)=O. |
| Q: What is the polar surface area (PSA) of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: Polar surface area (PSA) of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is 162.66000. |
| Q: What is the LogP of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: LogP of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is 1.86160. |
| Q: What is the CAS number of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide? |
| A: CAS number of 2-[5-(hydroxymethyl)furan-2-yl]-1,3-thiazole-4,5-dicarboxamide is 60084-08-4. |