benzyl N-(2,2-diethoxyethyl)carbamate structure
|
Common Name | benzyl N-(2,2-diethoxyethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 60085-61-2 | Molecular Weight | 267.32100 | |
| Density | 1.083g/cm3 | Boiling Point | 391.2ºC at 760 mmHg | |
| Molecular Formula | C14H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.4ºC | |
| Name | benzyl N-(2,2-diethoxyethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 391.2ºC at 760 mmHg |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32100 |
| Flash Point | 190.4ºC |
| Exact Mass | 267.14700 |
| PSA | 56.79000 |
| LogP | 2.70280 |
| Index of Refraction | 1.498 |
| InChIKey | YBQUFRCXCFAQQM-UHFFFAOYSA-N |
| SMILES | CCOC(CNC(=O)OCc1ccccc1)OCC |
| HS Code | 2924299090 |
|---|
|
~64%
benzyl N-(2,2-d... CAS#:60085-61-2 |
| Literature: Isoda; Yamaguchi; Satoh; Hirata Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2329 - 2336 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyloxycarbonylaminoacetaldehyde diethyl acetal |
| Benzyloxycarbonylamino-acetaldehyd-diaethylacetal |
| benzyl 2,2-diethoxyethylcarbamate |
| 2-Benzyloxycarbonylamino-1.1-diaethoxy-aethan |