4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid
4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid structure
|
Common Name | 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 60086-46-6 | Molecular Weight | 266.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8F2O2S |
|---|---|
| Molecular Weight | 266.26300 |
| Exact Mass | 266.02100 |
| PSA | 62.60000 |
| LogP | 3.81420 |
| InChIKey | IPDBSSDXGDFUAM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(F)cc1Sc1ccc(F)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-fluoro-2-(4-f... CAS#:60086-46-6 |
| Literature: SmithKline Corporation Patent: US4086350 A1, 1978 ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Fluor-2-(4-fluorphenylthio)-benzoesaeure |
| 4-fluoro-2-(4-fluorophenylthio)benzoic acid |
| Benzoic acid,4-fluoro-2-[(4-fluorophenyl)thio] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: InChIKey of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is IPDBSSDXGDFUAM-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: Polar surface area (PSA) of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is 62.60000. |
| Q: What is the molecular weight of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: Molecular weight of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is 266.26300. |
| Q: What is the molecular formula of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: Molecular formula of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is C13H8F2O2S. |
| Q: What is the LogP of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: LogP of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is 3.81420. |
| Q: What English synonyms does 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid have? |
| A: English synonyms of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid: 4-Fluor-2-(4-fluorphenylthio)-benzoesaeure, 4-fluoro-2-(4-fluorophenylthio)benzoic acid, Benzoic acid,4-fluoro-2-[(4-fluorophenyl)thio]. |
| Q: What is the Chinese name of 60086-46-6? |
| A: Chinese name of 60086-46-6 is 60086-46-6. |
| Q: What is the SMILES notation of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: SMILES notation of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is O=C(O)c1ccc(F)cc1Sc1ccc(F)cc1. |
| Q: What is the English name of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: The English name of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid. |
| Q: What is the CAS number of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid? |
| A: CAS number of 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid is 60086-46-6. |