ammonium urate
ammonium urate structure
|
Common Name | ammonium urate | ||
|---|---|---|---|---|
| CAS Number | 6009-66-1 | Molecular Weight | 187.15700 | |
| Density | N/A | Boiling Point | 585.2ºC at 760 mmHg | |
| Molecular Formula | C5H9N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 585.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C5H9N5O3 |
| Molecular Weight | 187.15700 |
| Flash Point | 307.7ºC |
| Exact Mass | 187.07100 |
| PSA | 113.04000 |
| InChIKey | FOFYPMPFTYORPL-UHFFFAOYSA-N |
| SMILES | N.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| U-6200 |
| uric acid amine |
| EINECS 227-862-2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: SMILES notation of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is N.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1. |
| Q: What is the boiling point of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: Boiling point of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is 585.2ºC at 760 mmHg. |
| Q: What is the InChIKey of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: InChIKey of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is FOFYPMPFTYORPL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: Molecular weight of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is 187.15700. |
| Q: What is the English name of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: The English name of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione. |
| Q: What is the polar surface area (PSA) of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: Polar surface area (PSA) of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is 113.04000. |
| Q: What is the molecular formula of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: Molecular formula of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is C5H9N5O3. |
| Q: What is the CAS number of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione? |
| A: CAS number of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione is 6009-66-1. |
| Q: What English synonyms does azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione have? |
| A: English synonyms of azane,4,5,7,9-tetrahydro-3H-purine-2,6,8-trione: U-6200, uric acid amine, EINECS 227-862-2. |