1-nitro-4-(3-phenylpropylsulfanyl)benzene
1-nitro-4-(3-phenylpropylsulfanyl)benzene structure
|
Common Name | 1-nitro-4-(3-phenylpropylsulfanyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 60091-81-8 | Molecular Weight | 273.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-nitro-4-(3-phenylpropylsulfanyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO2S |
|---|---|
| Molecular Weight | 273.35000 |
| Exact Mass | 273.08200 |
| PSA | 71.12000 |
| LogP | 4.84290 |
| InChIKey | FHNHVIXLVYZGOD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(SCCCc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-nitro-4-(3-ph... CAS#:60091-81-8 |
| Literature: Ciba-Geigy Corporation Patent: US4004907 A1, 1977 ; |
|
~79%
1-nitro-4-(3-ph... CAS#:60091-81-8 |
| Literature: Mukaiyama, Teruaki; Ikegai, Kazuhiro Chemistry Letters, 2004 , vol. 33, # 11 p. 1522 - 1523 |
|
~%
1-nitro-4-(3-ph... CAS#:60091-81-8 |
| Literature: Mukaiyama, Teruaki; Ikegai, Kazuhiro Chemistry Letters, 2004 , vol. 33, # 11 p. 1522 - 1523 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,1-nitro-4-[(3-phenylpropyl)thio] |
| 4-(3'-phenylpropylthio)-nitrobenzene |
| 4-(3'-Phenyl-propylthio)-nitrobenzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: InChIKey of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is FHNHVIXLVYZGOD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 60091-81-8? |
| A: Chinese name of 60091-81-8 is 60091-81-8. |
| Q: What is the molecular weight of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: Molecular weight of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is 273.35000. |
| Q: What is the molecular formula of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: Molecular formula of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is C15H15NO2S. |
| Q: What is the SMILES notation of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: SMILES notation of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is O=[N+]([O-])c1ccc(SCCCc2ccccc2)cc1. |
| Q: What is the LogP of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: LogP of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is 4.84290. |
| Q: What is the polar surface area (PSA) of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: Polar surface area (PSA) of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is 71.12000. |
| Q: What English synonyms does 1-nitro-4-(3-phenylpropylsulfanyl)benzene have? |
| A: English synonyms of 1-nitro-4-(3-phenylpropylsulfanyl)benzene: Benzene,1-nitro-4-[(3-phenylpropyl)thio], 4-(3'-phenylpropylthio)-nitrobenzene, 4-(3'-Phenyl-propylthio)-nitrobenzol. |
| Q: What is the CAS number of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: CAS number of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is 60091-81-8. |
| Q: What is the English name of 1-nitro-4-(3-phenylpropylsulfanyl)benzene? |
| A: The English name of 1-nitro-4-(3-phenylpropylsulfanyl)benzene is 1-nitro-4-(3-phenylpropylsulfanyl)benzene. |