(3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate structure
|
Common Name | (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 60102-22-9 | Molecular Weight | 671.04800 | |
| Density | 2.03g/cm3 | Boiling Point | 591.5ºC at 760 mmHg | |
| Molecular Formula | C16H20I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.5ºC | |
| Name | (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.03g/cm3 |
|---|---|
| Boiling Point | 591.5ºC at 760 mmHg |
| Molecular Formula | C16H20I3NO4 |
| Molecular Weight | 671.04800 |
| Flash Point | 311.5ºC |
| Exact Mass | 670.85300 |
| PSA | 68.12000 |
| LogP | 6.34180 |
| Index of Refraction | 1.647 |
| InChIKey | ZBGKRYZBUUXLKF-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)OCc1c(I)cc(I)c(NC(C)=O)c1I |
|
~%
(3-acetamido-2,... CAS#:60102-22-9 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
| Carbonic acid,(3-(acetylamino)-2,4,6-triiodophenyl)methyl hexyl ester |
| (3-(Acetylamino)-2,4,6-triiodophenyl)methyl hexyl carbonate |