Phosphorodiamidic acid,N,N-bis(2-chloroethyl)-N',N'-diethyl-, methyl ester structure
|
Common Name | Phosphorodiamidic acid,N,N-bis(2-chloroethyl)-N',N'-diethyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 60106-96-9 | Molecular Weight | 291.15500 | |
| Density | 1.188g/cm3 | Boiling Point | 336.8ºC at 760 mmHg | |
| Molecular Formula | C9H21Cl2N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.5ºC | |
| Name | 2-chloro-N-(2-chloroethyl)-N-[diethylamino(methoxy)phosphoryl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760 mmHg |
| Molecular Formula | C9H21Cl2N2O2P |
| Molecular Weight | 291.15500 |
| Flash Point | 157.5ºC |
| Exact Mass | 290.07200 |
| PSA | 42.59000 |
| LogP | 2.86230 |
| Index of Refraction | 1.479 |
| InChIKey | WNBPZMQYPMXIIA-UHFFFAOYSA-N |
| SMILES | CCN(CC)P(=O)(OC)N(CCCl)CCCl |
|
~69%
Phosphorodiamid... CAS#:60106-96-9 |
| Literature: Wan, Huijie; Modro, Tomasz A. Phosphorus, Sulfur and Silicon and Related Elements, 1996 , vol. 108, # 1-4 p. 155 - 168 |
| methyl N,N-diethyl-N',N'-bis-(2-chloroethyl)phosphordiamidate |