2,2',3,3',5-Pentachlorobiphenyl structure
|
Common Name | 2,2',3,3',5-Pentachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 60145-20-2 | Molecular Weight | 326.43300 | |
| Density | 1.522g/cm3 | Boiling Point | 377.9ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl5 | Melting Point | 65°C | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | 2,2',3,3',5-Pentachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760 mmHg |
| Melting Point | 65°C |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.43300 |
| Flash Point | 182.9ºC |
| Exact Mass | 323.88300 |
| LogP | 6.62060 |
| Index of Refraction | 1.619 |
| InChIKey | SUBRHHYLRGOTHL-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2cccc(Cl)c2Cl)c1 |
|
~10%
2,2',3,3',5-Pen... CAS#:60145-20-2 |
| Literature: Kylmaelae, Tuula; Kuuloja, Noora; Xu, Youjun; Rissanen, Kari; Franzen, Robert European Journal of Organic Chemistry, 2008 , # 23 p. 4019 - 4024 |
|
~%
2,2',3,3',5-Pen... CAS#:60145-20-2 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
| 1,2,5-trichloro-3-(2,3-dichlorophenyl)benzene |