1-Bromo-3-phenylsulfonyl-propan-2-one
1-Bromo-3-phenylsulfonyl-propan-2-one structure
|
Common Name | 1-Bromo-3-phenylsulfonyl-propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 60156-13-0 | Molecular Weight | 277.13500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Bromo-3-phenylsulfonyl-propan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9BrO3S |
|---|---|
| Molecular Weight | 277.13500 |
| Exact Mass | 275.94600 |
| PSA | 59.59000 |
| LogP | 2.50510 |
| InChIKey | JSMDGFFNIVDURQ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)CS(=O)(=O)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:71560-75-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-bromo-3-phenylsulfonyl-2-propanone |
| 1-Benzolsulfonyl-3-brom-aceton |
| α'-Brom-α-phenylsulfon-aceton |
| 1-Bromo-3-phenylsulphonylpropan-2-one |
| 1-bromomethyl-2-phenylsulfonylethanone |
| 1-benzenesulfonyl-3-bromo-acetone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: Related downstream products(CAS) of 1-Bromo-3-phenylsulfonyl-propan-2-one: 71560-75-3. |
| Q: What is the SMILES notation of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: SMILES notation of 1-Bromo-3-phenylsulfonyl-propan-2-one is O=C(CBr)CS(=O)(=O)c1ccccc1. |
| Q: What is the Chinese name of 60156-13-0? |
| A: Chinese name of 60156-13-0 is 60156-13-0. |
| Q: What is the InChIKey of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: InChIKey of 1-Bromo-3-phenylsulfonyl-propan-2-one is JSMDGFFNIVDURQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: Molecular weight of 1-Bromo-3-phenylsulfonyl-propan-2-one is 277.13500. |
| Q: What is the English name of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: The English name of 1-Bromo-3-phenylsulfonyl-propan-2-one is 1-Bromo-3-phenylsulfonyl-propan-2-one. |
| Q: What English synonyms does 1-Bromo-3-phenylsulfonyl-propan-2-one have? |
| A: English synonyms of 1-Bromo-3-phenylsulfonyl-propan-2-one: 1-bromo-3-phenylsulfonyl-2-propanone, 1-Benzolsulfonyl-3-brom-aceton, α'-Brom-α-phenylsulfon-aceton, 1-Bromo-3-phenylsulphonylpropan-2-one, 1-bromomethyl-2-phenylsulfonylethanone, 1-benzenesulfonyl-3-bromo-acetone. |
| Q: What is the LogP of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: LogP of 1-Bromo-3-phenylsulfonyl-propan-2-one is 2.50510. |
| Q: What is the CAS number of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: CAS number of 1-Bromo-3-phenylsulfonyl-propan-2-one is 60156-13-0. |
| Q: What is the molecular formula of 1-Bromo-3-phenylsulfonyl-propan-2-one? |
| A: Molecular formula of 1-Bromo-3-phenylsulfonyl-propan-2-one is C9H9BrO3S. |