3,9-bis(3-nitrophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane structure
|
Common Name | 3,9-bis(3-nitrophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 60171-64-4 | Molecular Weight | 402.35500 | |
| Density | 1.45g/cm3 | Boiling Point | 576.8ºC at 760 mmHg | |
| Molecular Formula | C19H18N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3ºC | |
| Name | 3,9-bis(3-nitrophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 576.8ºC at 760 mmHg |
| Molecular Formula | C19H18N2O8 |
| Molecular Weight | 402.35500 |
| Flash Point | 239.3ºC |
| Exact Mass | 402.10600 |
| PSA | 128.56000 |
| LogP | 4.32680 |
| Index of Refraction | 1.635 |
| InChIKey | LRYMBMFAOCJSES-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C2OCC3(CO2)COC(c2cccc([N+](=O)[O-])c2)OC3)c1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3,9-bis-(3-nitro-phenyl)-2,4,8,10-tetraoxa-spiro[5.5]undecane |