2-Anthracenecarbonylchloride, 9,10-dihydro-1-nitro-9,10-dioxo structure
|
Common Name | 2-Anthracenecarbonylchloride, 9,10-dihydro-1-nitro-9,10-dioxo | ||
|---|---|---|---|---|
| CAS Number | 602-10-8 | Molecular Weight | 315.66500 | |
| Density | 1.599g/cm3 | Boiling Point | 543.2ºC at 760 mmHg | |
| Molecular Formula | C15H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.3ºC | |
| Name | 1-nitro-9,10-dioxoanthracene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.599g/cm3 |
|---|---|
| Boiling Point | 543.2ºC at 760 mmHg |
| Molecular Formula | C15H6ClNO5 |
| Molecular Weight | 315.66500 |
| Flash Point | 282.3ºC |
| Exact Mass | 314.99300 |
| PSA | 97.03000 |
| LogP | 3.27240 |
| Index of Refraction | 1.69 |
| InChIKey | NWFOTILLJRKQQH-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(C(=O)Cl)c2[N+](=O)[O-] |
|
~89%
2-Anthracenecar... CAS#:602-10-8 |
| Literature: Kucherov; Zlotin Russian Chemical Bulletin, 2001 , vol. 50, # 9 p. 1657 - 1662 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-Nitro-9.10-dioxo-9.10-dihydro-anthracen-carbonsaeure-(2)-chlorid |
| 1-nitro-2-chlorocarbonylanthraquinone |
| 1-Nitro-9,10-dioxo-9,10-dihydro-anthracen-2-carbonylchlorid |
| 1-nitro-9,10-dioxo-9,10-dihydro-anthracene-2-carbonyl chloride |
| 1-nitro-2-chlorocarbonyl-9,10-anthraquinone |
| 1-nitro-2-anthraquinonecarbonyl chloride |