1,3,5-Trimethyl-2,4,6-trinitrobenzene structure
|
Common Name | 1,3,5-Trimethyl-2,4,6-trinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 602-96-0 | Molecular Weight | 255.18400 | |
| Density | 1.468g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C9H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.4ºC | |
| Name | 1,3,5-trimethyl-2,4,6-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Molecular Formula | C9H9N3O6 |
| Molecular Weight | 255.18400 |
| Flash Point | 173.4ºC |
| Exact Mass | 255.04900 |
| PSA | 137.46000 |
| LogP | 3.90600 |
| Index of Refraction | 1.611 |
| InChIKey | YVJCXMCIFPUNDO-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C)c1[N+](=O)[O-] |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 1,3,5-trinitromesitylene |
| 1,3,5-trimethyl-2,4,6-trinitro-benzene |
| 2,6-Trinitromesitylene |
| 1,3,5-Trimethyl-2,4,6-trinitro-benzol |
| Trinitromesitylene |
| Mesitylene,4,6-trinitro |
| 2,4,6-Trinitromesitylene |
| 1,3,5-trinitro-2,4,6-tri-methyl benzene |