ac1l86lx structure
|
Common Name | ac1l86lx | ||
|---|---|---|---|---|
| CAS Number | 60204-78-6 | Molecular Weight | 197.27400 | |
| Density | 1.13g/cm3 | Boiling Point | 245.4ºC at 760 mmHg | |
| Molecular Formula | C11H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ac1l86lx |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 245.4ºC at 760 mmHg |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.27400 |
| Exact Mass | 197.14200 |
| PSA | 21.70000 |
| LogP | 1.66170 |
| Index of Refraction | 1.534 |
| InChIKey | RYGCJJYYENVKBS-UHFFFAOYSA-N |
| SMILES | CCC12COC3(C)CCC(C)(OC1)N23 |
|
~%
ac1l86lx CAS#:60204-78-6 |
| Literature: Broadbent,H.S. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 337 - 348 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2a-ethyl-4a,6a-dimethyl-hexahydro-1,4-dioxa-6b-aza-cyclopenta[cd]pentalene |