2,4-dibromo-2-(bromomethyl)pentanedioic acid structure
|
Common Name | 2,4-dibromo-2-(bromomethyl)pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 60239-16-9 | Molecular Weight | 382.82900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7Br3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dibromo-2-(bromomethyl)pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7Br3O4 |
|---|---|
| Molecular Weight | 382.82900 |
| Exact Mass | 379.78900 |
| PSA | 74.60000 |
| LogP | 1.83780 |
| InChIKey | RGGMSIXCKYMHAI-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Br)CC(Br)(CBr)C(=O)O |
|
~%
2,4-dibromo-2-(... CAS#:60239-16-9 |
| Literature: Dowd,P.; Marwaha,L.K. Journal of Organic Chemistry, 1976 , vol. 41, p. 4035 - 4036 |
|
~%
2,4-dibromo-2-(... CAS#:60239-16-9 |
| Literature: Dowd,P.; Marwaha,L.K. Journal of Organic Chemistry, 1976 , vol. 41, p. 4035 - 4036 |
| 2,4-Dibrom-2-brommethyl-glutarsaeure |
| Pentanedioic acid,2,4-dibromo-2-(bromomethyl) |
| 2,4-dibromo-2-bromomethyl-glutaric acid |