Ethyl 1-hydroxy-4-oxo-2,5-cyclohexadien-1-acetate structure
|
Common Name | Ethyl 1-hydroxy-4-oxo-2,5-cyclohexadien-1-acetate | ||
|---|---|---|---|---|
| CAS Number | 60263-06-1 | Molecular Weight | 196.200 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 338.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.5±21.4 °C | |
| Name | ethyl 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.6±42.0 °C at 760 mmHg |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.200 |
| Flash Point | 133.5±21.4 °C |
| Exact Mass | 196.073563 |
| PSA | 63.60000 |
| LogP | 0.28 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | PCTPJULDTWCNKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(O)C=CC(=O)C=C1 |
| HS Code | 2918990090 |
|---|
|
~71%
Ethyl 1-hydroxy... CAS#:60263-06-1 |
| Literature: Araki, Shuki; Katsumura, Nobuhito; Kawasaki, Ken-ichi; Butsugan, Yasuo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 3 p. 499 - 500 |
|
~%
Ethyl 1-hydroxy... CAS#:60263-06-1 |
| Literature: Siegel; Keckeis Monatshefte fuer Chemie, 1953 , vol. 84, p. 910,917 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (1-Hydroxy-4-oxo-cyclohexa-2,5-dienyl)-essigsaeure-aethylester |
| ethyl (1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| 2,5-Cyclohexadiene-1-acetic acid, 1-hydroxy-4-oxo-, ethyl ester |
| JP-2 |
| ETHYL 2-(1-HYDROXY-4-OXO-1-CYCLOHEXA-2,5-DIENYL)ACETATE |
| (1-hydroxy-4-oxo-cyclohexa-2,5-dienyl)-acetic acid ethyl ester |
| Ethyl (1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)acetate |
| Ethyl 1-hydroxy-4-oxo-2,5-cyclohexadien-1-acetate |