T Epitope, Threonyl
T Epitope, Threonyl structure
|
Common Name | T Epitope, Threonyl | ||
|---|---|---|---|---|
| CAS Number | 60280-58-2 | Molecular Weight | 484.45200 | |
| Density | 1.587g/cm3 | Boiling Point | 872.474ºC at 760 mmHg | |
| Molecular Formula | C18H32N2O13 | Melting Point | >170ºC(dec.) | |
| MSDS | N/A | Flash Point | 481.455ºC | |
Summary: Galβ(1-3)GalNAc-α-Thr, also known as T Epitope, Threonyl, with CAS number 60280-58-2, molecular formula C18H32N2O13, and molecular weight 484.45200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Gal β(1-3)GalNAc-α-Thr |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.587g/cm3 |
|---|---|
| Boiling Point | 872.474ºC at 760 mmHg |
| Melting Point | >170ºC(dec.) |
| Molecular Formula | C18H32N2O13 |
| Molecular Weight | 484.45200 |
| Flash Point | 481.455ºC |
| Exact Mass | 484.19000 |
| PSA | 250.72000 |
| Index of Refraction | 1.613 |
| InChIKey | VWNOCGQJSBAAFO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(OC(C)C(N)C(=O)O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
![O-(2,3,4,6-Tetra-O-acetyl-β-D-galactopyranosyl)-(1[*]3)-O-(2-acetamido-2-desoxy-α-D-galactopyranosyl)-(1[*]3)-L-threonin Structure](https://image.chemsrc.com/caspic/366/83956-47-2.png)
CAS#:83956-47-2
CAS#:3150-24-1
CAS#:87376-57-6
CAS#:87376-56-5
CAS#:67817-37-2
CAS#:83956-45-0
CAS#:83956-46-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| T Epitope, Threonyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of Gal β(1-3)GalNAc-α-Thr? |
| A: Related upstream materials(CAS) of Gal β(1-3)GalNAc-α-Thr: 83956-47-2;3150-24-1;87376-57-6;87376-56-5;67817-37-2;83956-45-0;83956-46-1. |
| Q: What is the molecular weight of Gal β(1-3)GalNAc-α-Thr? |
| A: Molecular weight of Gal β(1-3)GalNAc-α-Thr is 484.45200. |
| Q: What is the molecular formula of Gal β(1-3)GalNAc-α-Thr? |
| A: Molecular formula of Gal β(1-3)GalNAc-α-Thr is C18H32N2O13. |
| Q: What is the boiling point of Gal β(1-3)GalNAc-α-Thr? |
| A: Boiling point of Gal β(1-3)GalNAc-α-Thr is 872.474ºC at 760 mmHg. |
| Q: What is the English name of Gal β(1-3)GalNAc-α-Thr? |
| A: The English name of Gal β(1-3)GalNAc-α-Thr is Gal β(1-3)GalNAc-α-Thr. |
| Q: What is the melting point of Gal β(1-3)GalNAc-α-Thr? |
| A: Melting point of Gal β(1-3)GalNAc-α-Thr is >170ºC(dec.). |
| Q: What English synonyms does Gal β(1-3)GalNAc-α-Thr have? |
| A: English synonyms of Gal β(1-3)GalNAc-α-Thr: T Epitope, Threonyl. |
| Q: What is the CAS number of Gal β(1-3)GalNAc-α-Thr? |
| A: CAS number of Gal β(1-3)GalNAc-α-Thr is 60280-58-2. |
| Q: What is the InChIKey of Gal β(1-3)GalNAc-α-Thr? |
| A: InChIKey of Gal β(1-3)GalNAc-α-Thr is VWNOCGQJSBAAFO-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of Gal β(1-3)GalNAc-α-Thr? |
| A: Polar surface area (PSA) of Gal β(1-3)GalNAc-α-Thr is 250.72000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |