trans-(+)-o-Diselenane-3,6-dicarboxylic acid
Modify Date: 2026-08-04 06:48:25
trans-(+)-o-Diselenane-3,6-dicarboxylic acid structure
|
Common Name | trans-(+)-o-Diselenane-3,6-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 60295-67-2 | Molecular Weight | 302.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8O4Se2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trans-(+)-o-Diselenane-3,6-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8O4Se2 |
|---|---|
| Molecular Weight | 302.07 |
| InChIKey | JAGJLCZKVMJJDA-IMJSIDKUSA-N |
| SMILES | O=C(O)C1CCC(C(=O)O)[Se][Se]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of trans-(+)-o-Diselenane-3,6-dicarboxylic acid? |
| A: SMILES notation of trans-(+)-o-Diselenane-3,6-dicarboxylic acid is O=C(O)C1CCC(C(=O)O)[Se][Se]1. |
| Q: What is the molecular weight of trans-(+)-o-Diselenane-3,6-dicarboxylic acid? |
| A: Molecular weight of trans-(+)-o-Diselenane-3,6-dicarboxylic acid is 302.07. |
| Q: What is the English name of trans-(+)-o-Diselenane-3,6-dicarboxylic acid? |
| A: The English name of trans-(+)-o-Diselenane-3,6-dicarboxylic acid is trans-(+)-o-Diselenane-3,6-dicarboxylic acid. |
| Q: What is the molecular formula of trans-(+)-o-Diselenane-3,6-dicarboxylic acid? |
| A: Molecular formula of trans-(+)-o-Diselenane-3,6-dicarboxylic acid is C6H8O4Se2. |
| Q: What is the Chinese name of 60295-67-2? |
| A: Chinese name of 60295-67-2 is 60295-67-2. |
| Q: What is the CAS number of trans-(+)-o-Diselenane-3,6-dicarboxylic acid? |
| A: CAS number of trans-(+)-o-Diselenane-3,6-dicarboxylic acid is 60295-67-2. |
| Q: What is the InChIKey of trans-(+)-o-Diselenane-3,6-dicarboxylic acid? |
| A: InChIKey of trans-(+)-o-Diselenane-3,6-dicarboxylic acid is JAGJLCZKVMJJDA-IMJSIDKUSA-N. |