2,2',2''-nitrilotrisethanol, compound with 1H-benzotriazole (1:1) structure
|
Common Name | 2,2',2''-nitrilotrisethanol, compound with 1H-benzotriazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 60303-08-4 | Molecular Weight | 268.312 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2',2''-Nitrilotriethanol-2H-benzotriazole (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20N4O3 |
|---|---|
| Molecular Weight | 268.312 |
| Exact Mass | 268.153534 |
| InChIKey | YOQINPWXHSJWDI-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)CCO.c1ccc2n[nH]nc2c1 |
| EINECS 262-152-6 |
| Ethanol, 2,2',2''-nitrilotris-, compd. with 2H-1,2,3-benzotriazole (1:1) |
| 2,2',2''-Nitrilotriethanol - 2H-benzotriazole (1:1) |
| EINECS 260-803-9 |