3-Fluoro-5-methylphenylalanine structure
|
Common Name | 3-Fluoro-5-methylphenylalanine | ||
|---|---|---|---|---|
| CAS Number | 603106-28-1 | Molecular Weight | 197.206 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 321.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.0±27.9 °C | |
| Name | 2-amino-3-(3-fluoro-5-methylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.0±42.0 °C at 760 mmHg |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.206 |
| Flash Point | 148.0±27.9 °C |
| Exact Mass | 197.085205 |
| PSA | 63.32000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | OEGJALAYWIUJRR-UHFFFAOYSA-N |
| SMILES | Cc1cc(F)cc(CC(N)C(=O)O)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Phenylalanine, 3-fluoro-5-methyl- |
| DL-3-Fluoro-5-methylphenylalanine |
| 3-Fluoro-5-methylphenylalanine |
| QVYZ1R CF E1 &&DL Form |
| 2-Amino-3-(3-fluoro-5-methylphenyl)propanoic acid |
| 3-Fluoro-5-methyl-dl-phenylalanine |