methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate
![methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate Structure](https://image.chemsrc.com/caspic/211/603122-83-4.png)
methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate structure
|
Common Name | methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate | ||
|---|---|---|---|---|
| CAS Number | 603122-83-4 | Molecular Weight | 302.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6F4O5S |
|---|---|
| Molecular Weight | 302.20000 |
| Exact Mass | 301.98700 |
| PSA | 78.05000 |
| LogP | 2.92150 |
| InChIKey | HLEMPMSWGIGAAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c(F)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:603122-79-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-fluoro-4-trifluoromethanesulfoxybenzoic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: Related downstream products(CAS) of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate: 603122-79-8. |
| Q: What is the InChIKey of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: InChIKey of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is HLEMPMSWGIGAAZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: CAS number of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is 603122-83-4. |
| Q: What is the English name of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: The English name of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate. |
| Q: What is the Chinese name of 603122-83-4? |
| A: Chinese name of 603122-83-4 is 603122-83-4. |
| Q: What is the molecular weight of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: Molecular weight of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is 302.20000. |
| Q: What is the polar surface area (PSA) of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: Polar surface area (PSA) of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is 78.05000. |
| Q: What is the molecular formula of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: Molecular formula of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is C9H6F4O5S. |
| Q: What English synonyms does methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate have? |
| A: English synonyms of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate: 3-fluoro-4-trifluoromethanesulfoxybenzoic acid methyl ester. |
| Q: What is the LogP of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate? |
| A: LogP of methyl 3-fluoro-4-{[(trifluoromethyl)sulfonyl]oxy}benzoate is 2.92150. |