Benzenepropanoic acid, a-(hydroxyimino)-b-oxo-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, a-(hydroxyimino)-b-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 60317-41-1 | Molecular Weight | 221.20900 | |
| Density | 1.2g/cm3 | Boiling Point | 366.3ºC at 760mmHg | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | ethyl (2Z)-2-hydroxyimino-3-oxo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 366.3ºC at 760mmHg |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.20900 |
| Flash Point | 175.3ºC |
| Exact Mass | 221.06900 |
| PSA | 75.96000 |
| LogP | 1.26260 |
| Index of Refraction | 1.539 |
| InChIKey | ZFHSZJKODSFZBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(N=O)=C(O)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| HMS1580K06 |
| 2-Hydroxyimino-3-oxo-3-phenyl-propionsaeure-aethylester |
| ethyl (E/Z)-2-hydroxyimino-3-oxo-3-phenylpropanoate |
| 2-hydroxyimino-3-oxo-3-phenyl-propionic acid ethyl ester |
| UPCMLD00WMAL3-43 |
| ethyl 2-hydroxyimino-3-oxo-3-phenylpropanoate |
| UPCMLD00WMAL3-43:002 |