2-Bromo-6-methyl-4-nitropyridine 1-oxide structure
|
Common Name | 2-Bromo-6-methyl-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 60323-99-1 | Molecular Weight | 233.020 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 440.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2±27.3 °C | |
| Name | 2-bromo-6-methyl-4-nitro-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.6±40.0 °C at 760 mmHg |
| Molecular Formula | C6H5BrN2O3 |
| Molecular Weight | 233.020 |
| Flash Point | 220.2±27.3 °C |
| Exact Mass | 231.948349 |
| PSA | 71.28000 |
| LogP | 0.48 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | FXJATGFTSNBVNK-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc(Br)[n+]1[O-] |
| HS Code | 2933399090 |
|---|
|
~82%
2-Bromo-6-methy... CAS#:60323-99-1 |
| Literature: SIRTRIS PHARMACEUTICALS, INC.; CASAUBON, Rebecca, L.; NARAYAN, Radha; OALMANN, Christopher; VU, Chi, B. Patent: WO2013/59587 A1, 2013 ; Location in patent: Page/Page column 165; 166 ; |
|
~%
2-Bromo-6-methy... CAS#:60323-99-1 |
| Literature: Walton, James W.; Bourdolle, Adrien; Butler, Stephen J.; Soulie, Marine; Delbianco, Martina; McMahon, Brian K.; Pal, Robert; Puschmann, Horst; Zwier, Jurriaan M.; Lamarque, Laurent; Maury, Olivier; Andraud, Chantal; Parker, David Chemical Communications, 2013 , vol. 49, # 16 p. 1600 - 1602 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-bromo-6-methyl-4-nitro-pyridine-1-oxide |
| 2-BROMO-6-METHYL-4-NITROPYRIDIN-1-OXIDE |
| 6-Bromo-4-nitro-α-picoline 1-oxide |
| T6NJ AO BE DNW F1 |
| 6-Bromo-2-methyl-4-nitropyridine-n-oxide |
| 2-Bromo-6-methyl-4-nitropyridine N-oxide |
| 2-Bromo-6-methyl-4-nitropyridine 1-oxide |
| Pyridine, 2-bromo-6-methyl-4-nitro-, 1-oxide |
| 6-Bromo-4-nitro-α-picoline N-oxide |