3-(4-bromophenyl)-3-(3-pyridyl)allylamine
Modify Date: 2025-09-10 18:27:22
3-(4-bromophenyl)-3-(3-pyridyl)allylamine structure
|
Common Name | 3-(4-bromophenyl)-3-(3-pyridyl)allylamine | ||
|---|---|---|---|---|
| CAS Number | 60324-67-6 | Molecular Weight | 289.17000 | |
| Density | 1.377g/cm3 | Boiling Point | 426.1ºC at 760 mmHg | |
| Molecular Formula | C14H13BrN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5ºC | |
| Name | 3-(4-bromophenyl)-3-pyridin-3-ylprop-2-en-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 426.1ºC at 760 mmHg |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.17000 |
| Flash Point | 211.5ºC |
| Exact Mass | 288.02600 |
| PSA | 38.91000 |
| LogP | 3.93480 |
| Index of Refraction | 1.627 |
| InChIKey | BVLDJXBFPHUCMZ-DMALGBCRSA-N |
| SMILES | Cl.Cl.NCC=C(c1ccc(Br)cc1)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(4-BROMOPHENYL)-3-(PYRIDIN-3-YL)ALLYLAMINE |
| CPP 200 |
| (Z)-3-(4-bromophenyl)-3-(3-pyridyl)allylamine |
| 2-Propen-1-amine,3-(4-bromophenyl)-3-(3-pyridinyl)-,(2Z) |
| 2-Propen-1-amine,3-(4-bromophenyl)-3-(3-pyridinyl)-,(Z) |