6-chloro-3-phenylpyridazin-4-ol, compound with 2-(dimethylamino)ethanol (1:1) structure
|
Common Name | 6-chloro-3-phenylpyridazin-4-ol, compound with 2-(dimethylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 60329-47-7 | Molecular Weight | 295.76500 | |
| Density | N/A | Boiling Point | 315.3ºC at 760 mmHg | |
| Molecular Formula | C14H18ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | 6-chloro-3-phenyl-1H-pyridazin-4-one,2-(dimethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.76500 |
| Flash Point | 144.5ºC |
| Exact Mass | 295.10900 |
| PSA | 69.48000 |
| LogP | 2.04290 |
| InChIKey | PXDRNCIPDKTABW-UHFFFAOYSA-N |
| SMILES | CN(C)CCO.O=c1cc(Cl)[nH]nc1-c1ccccc1 |
| einecs 262-181-4 |