6-chloro-3-phenylpyridazin-4-ol, compound with methylamine (1:1) structure
|
Common Name | 6-chloro-3-phenylpyridazin-4-ol, compound with methylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 60329-58-0 | Molecular Weight | 237.68500 | |
| Density | N/A | Boiling Point | 315.3ºC at 760 mmHg | |
| Molecular Formula | C11H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | 6-chloro-3-phenyl-1H-pyridazin-4-one,methanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.68500 |
| Flash Point | 144.5ºC |
| Exact Mass | 237.06700 |
| PSA | 72.03000 |
| LogP | 2.77780 |
| InChIKey | IGZHXXLDTOQYAM-UHFFFAOYSA-N |
| SMILES | CN.O=c1cc(Cl)[nH]nc1-c1ccccc1 |
| EINECS 262-183-5 |
| 6-Chloro-3-phenylpyridazin-4-ol,compound with methylamine (1:1) |