ethyl 3-amino-5-(trifluoromethyl)-1H-indazole-1-carboxylate structure
|
Common Name | ethyl 3-amino-5-(trifluoromethyl)-1H-indazole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 60330-12-3 | Molecular Weight | 273.21100 | |
| Density | 1.5g/cm3 | Boiling Point | 393.4ºC at 760 mmHg | |
| Molecular Formula | C11H10F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | ethyl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 393.4ºC at 760 mmHg |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21100 |
| Flash Point | 191.7ºC |
| Exact Mass | 273.07300 |
| PSA | 70.87000 |
| LogP | 2.57200 |
| Index of Refraction | 1.564 |
| InChIKey | UGXOEWBGAICBHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)n1nc(N)c2cc(C(F)(F)F)ccc21 |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 3-amino-5... CAS#:60330-12-3 |
| Literature: Bayer Aktiengesellschaft Patent: US4051252 A1, 1977 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BAY-f 1936 |
| EINECS 262-185-6 |
| 1H-Indazole-1-carboxylicacid,3-amino-5-(trifluoromethyl)-,ethyl ester |
| 3-amino-5-trifluoromethyl-indazole-1-carboxylic acid ethyl ester |
| Ethyl 3-amino-5-(trifluoromethyl)-1H-indazole-1-carboxylate |