2-methoxy-5,6,7,8-tetrahydronaphthoic acid
2-methoxy-5,6,7,8-tetrahydronaphthoic acid structure
|
Common Name | 2-methoxy-5,6,7,8-tetrahydronaphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 60346-40-9 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxy-5,6,7,8-tetrahydronaphthoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 46.53000 |
| LogP | 2.27220 |
| InChIKey | XCCRLEOPTMKRRF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1C(=O)O)CCCC2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:59604-96-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,6,7,8-tetrahydro-2-methoxy-1-naphthalenecarboxylic acid |
| 2-Methoxy-5,6,7,8-tetrahydro-[1]naphthoesaeure |
| 5.6.7.8-Tetrahydro-2-methoxy-1-naphthoesaeure |
| 2-methoxy-5,6,7,8-tetrahydro-[1]naphthoic acid |
| 2-methoxy-5,6,7,8-tetrahydro-1-naphthalenecarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 60346-40-9? |
| A: Chinese name of 60346-40-9 is 60346-40-9. |
| Q: What is the CAS number of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: CAS number of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is 60346-40-9. |
| Q: What is the English name of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: The English name of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is 2-methoxy-5,6,7,8-tetrahydronaphthoic acid. |
| Q: What is the polar surface area (PSA) of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: Polar surface area (PSA) of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is 46.53000. |
| Q: What is the SMILES notation of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: SMILES notation of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is COc1ccc2c(c1C(=O)O)CCCC2. |
| Q: What is the molecular weight of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: Molecular weight of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is 206.23800. |
| Q: What is the LogP of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: LogP of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is 2.27220. |
| Q: What are the downstream products of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: Related downstream products(CAS) of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid: 59604-96-5. |
| Q: What is the molecular formula of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid? |
| A: Molecular formula of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid is C12H14O3. |
| Q: What English synonyms does 2-methoxy-5,6,7,8-tetrahydronaphthoic acid have? |
| A: English synonyms of 2-methoxy-5,6,7,8-tetrahydronaphthoic acid: 5,6,7,8-tetrahydro-2-methoxy-1-naphthalenecarboxylic acid, 2-Methoxy-5,6,7,8-tetrahydro-[1]naphthoesaeure, 5.6.7.8-Tetrahydro-2-methoxy-1-naphthoesaeure, 2-methoxy-5,6,7,8-tetrahydro-[1]naphthoic acid, 2-methoxy-5,6,7,8-tetrahydro-1-naphthalenecarboxylic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |