(4-Nitrophenyl)acetic acid benzyl ester
(4-Nitrophenyl)acetic acid benzyl ester structure
|
Common Name | (4-Nitrophenyl)acetic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 6035-06-9 | Molecular Weight | 271.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Benzyl p-nitrophenylacetate, Chinese name: 苯基对硝基苯乙酸酯, CAS number: 6035-06-9, molecular formula: C15H13NO4, molecular weight: 271.26800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl p-nitrophenylacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13NO4 |
|---|---|
| Molecular Weight | 271.26800 |
| Exact Mass | 271.08400 |
| PSA | 72.12000 |
| LogP | 3.40390 |
| InChIKey | PVOLVGFQIIACPQ-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:104-03-0
CAS#:100-51-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Nitrophenylessigsaeure-benzylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl p-nitrophenylacetate? |
| A: Molecular formula of benzyl p-nitrophenylacetate is C15H13NO4. |
| Q: What is the SMILES notation of benzyl p-nitrophenylacetate? |
| A: SMILES notation of benzyl p-nitrophenylacetate is O=C(Cc1ccc([N+](=O)[O-])cc1)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of benzyl p-nitrophenylacetate? |
| A: Polar surface area (PSA) of benzyl p-nitrophenylacetate is 72.12000. |
| Q: What is the LogP of benzyl p-nitrophenylacetate? |
| A: LogP of benzyl p-nitrophenylacetate is 3.40390. |
| Q: What is the CAS number of benzyl p-nitrophenylacetate? |
| A: CAS number of benzyl p-nitrophenylacetate is 6035-06-9. |
| Q: What English synonyms does benzyl p-nitrophenylacetate have? |
| A: English synonyms of benzyl p-nitrophenylacetate: p-Nitrophenylessigsaeure-benzylester. |
| Q: What is the molecular weight of benzyl p-nitrophenylacetate? |
| A: Molecular weight of benzyl p-nitrophenylacetate is 271.26800. |
| Q: What is the InChIKey of benzyl p-nitrophenylacetate? |
| A: InChIKey of benzyl p-nitrophenylacetate is PVOLVGFQIIACPQ-UHFFFAOYSA-N. |
| Q: What are the downstream products of benzyl p-nitrophenylacetate? |
| A: Related downstream products(CAS) of benzyl p-nitrophenylacetate: 104-03-0;100-51-6. |
| Q: What is the Chinese name of 6035-06-9? |
| A: Chinese name of 6035-06-9 is 6035-06-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |