[2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate
![[2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate Structure](https://image.chemsrc.com/caspic/380/60359-77-5.png)
[2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate structure
|
Common Name | [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate | ||
|---|---|---|---|---|
| CAS Number | 60359-77-5 | Molecular Weight | 296.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20O6 |
|---|---|
| Molecular Weight | 296.31600 |
| Exact Mass | 296.12600 |
| PSA | 71.06000 |
| LogP | 1.57680 |
| InChIKey | LTUFQQODWMDMJT-UHFFFAOYSA-N |
| SMILES | CC(C)OCC(=O)OCC(=O)OCCOc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-oxo-2-(2-phe... CAS#:60359-77-5 |
| Literature: Nissan Chem. Patent: FR2279333DE2519433 , 19761976 ; Chem.Abstr., 1976 , vol. 85, # 123623 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetic acid,(1-methylethoxy)-,2-oxo-2-(2-phenoxyethoxy)ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: InChIKey of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is LTUFQQODWMDMJT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: SMILES notation of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is CC(C)OCC(=O)OCC(=O)OCCOc1ccccc1. |
| Q: What is the molecular formula of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: Molecular formula of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is C15H20O6. |
| Q: What is the polar surface area (PSA) of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: Polar surface area (PSA) of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is 71.06000. |
| Q: What English synonyms does [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate have? |
| A: English synonyms of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate: Acetic acid,(1-methylethoxy)-,2-oxo-2-(2-phenoxyethoxy)ethyl ester. |
| Q: What is the CAS number of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: CAS number of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is 60359-77-5. |
| Q: What is the LogP of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: LogP of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is 1.57680. |
| Q: What is the English name of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: The English name of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate. |
| Q: What is the molecular weight of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate? |
| A: Molecular weight of [2-oxo-2-(2-phenoxyethoxy)ethyl] 2-propan-2-yloxyacetate is 296.31600. |
| Q: What is the Chinese name of 60359-77-5? |
| A: Chinese name of 60359-77-5 is 60359-77-5. |