Naphthalene-1-sulfonic acid hydrate, structure
|
Common Name | Naphthalene-1-sulfonic acid hydrate, | ||
|---|---|---|---|---|
| CAS Number | 6036-48-2 | Molecular Weight | 244.26400 | |
| Density | N/A | Boiling Point | 605.7ºC at 760 mmHg | |
| Molecular Formula | C10H12O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.1ºC | |
| Name | naphthalene-1-sulfonic acid,hydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 605.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H12O5S |
| Molecular Weight | 244.26400 |
| Flash Point | 320.1ºC |
| Exact Mass | 244.04100 |
| PSA | 81.21000 |
| LogP | 3.03870 |
| InChIKey | DCNHVBSAFCNMBK-UHFFFAOYSA-N |
| SMILES | O.O=S(=O)(O)c1cccc2ccccc12 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| naphthalene-1-sulfonic acid hydrate |