2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate
2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate structure
|
Common Name | 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 60361-89-9 | Molecular Weight | 233.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7NO5 |
|---|---|
| Molecular Weight | 233.17700 |
| Exact Mass | 233.03200 |
| PSA | 72.91000 |
| LogP | 0.97990 |
| InChIKey | DCDVGWBIRNCZLK-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)ON1C(=O)C=CC1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4814-74-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: SMILES notation of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is O=C(Oc1ccccc1)ON1C(=O)C=CC1=O. |
| Q: What is the polar surface area (PSA) of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: Polar surface area (PSA) of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is 72.91000. |
| Q: What is the molecular weight of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: Molecular weight of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is 233.17700. |
| Q: What is the InChIKey of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: InChIKey of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is DCDVGWBIRNCZLK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 60361-89-9? |
| A: Chinese name of 60361-89-9 is 60361-89-9. |
| Q: What is the LogP of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: LogP of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is 0.97990. |
| Q: What is the molecular formula of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: Molecular formula of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is C11H7NO5. |
| Q: What is the CAS number of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: CAS number of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is 60361-89-9. |
| Q: What is the English name of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: The English name of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate is 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate. |
| Q: What are the downstream products of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate? |
| A: Related downstream products(CAS) of 2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl phenyl carbonate: 4814-74-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |