5-trimethylsilyldecan-4-one
5-trimethylsilyldecan-4-one structure
|
Common Name | 5-trimethylsilyldecan-4-one | ||
|---|---|---|---|---|
| CAS Number | 60366-68-9 | Molecular Weight | 228.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H28OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-trimethylsilyldecan-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H28OSi |
|---|---|
| Molecular Weight | 228.44600 |
| Exact Mass | 228.19100 |
| PSA | 17.07000 |
| LogP | 4.64430 |
| InChIKey | XMEPNFZEHQPZKE-UHFFFAOYSA-N |
| SMILES | CCCCCC(C(=O)CCC)[Si](C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-trimethylsily... CAS#:60366-68-9 |
| Literature: Sato, Susumu; Matsuda, Isamu; Izumi, Yusuke Journal of Organometallic Chemistry, 1988 , vol. 344, p. 71 - 88 |
|
~%
5-trimethylsily... CAS#:60366-68-9 |
| Literature: Obayashi,M. et al. Bulletin of the Chemical Society of Japan, 1979 , vol. 52, p. 2646 - 2652 |
|
~%
5-trimethylsily... CAS#:60366-68-9 |
| Literature: Obayashi,M. et al. Bulletin of the Chemical Society of Japan, 1979 , vol. 52, p. 2646 - 2652 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Trimethylsilyl-4-decanon |
| 4-Decanone,5-(trimethylsilyl) |
| 5-trimethylsilanyl-decan-4-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 5-trimethylsilyldecan-4-one have? |
| A: English synonyms of 5-trimethylsilyldecan-4-one: 5-Trimethylsilyl-4-decanon, 4-Decanone,5-(trimethylsilyl), 5-trimethylsilanyl-decan-4-one. |
| Q: What is the polar surface area (PSA) of 5-trimethylsilyldecan-4-one? |
| A: Polar surface area (PSA) of 5-trimethylsilyldecan-4-one is 17.07000. |
| Q: What is the CAS number of 5-trimethylsilyldecan-4-one? |
| A: CAS number of 5-trimethylsilyldecan-4-one is 60366-68-9. |
| Q: What is the molecular weight of 5-trimethylsilyldecan-4-one? |
| A: Molecular weight of 5-trimethylsilyldecan-4-one is 228.44600. |
| Q: What is the LogP of 5-trimethylsilyldecan-4-one? |
| A: LogP of 5-trimethylsilyldecan-4-one is 4.64430. |
| Q: What is the English name of 5-trimethylsilyldecan-4-one? |
| A: The English name of 5-trimethylsilyldecan-4-one is 5-trimethylsilyldecan-4-one. |
| Q: What is the InChIKey of 5-trimethylsilyldecan-4-one? |
| A: InChIKey of 5-trimethylsilyldecan-4-one is XMEPNFZEHQPZKE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 60366-68-9? |
| A: Chinese name of 60366-68-9 is 60366-68-9. |
| Q: What is the SMILES notation of 5-trimethylsilyldecan-4-one? |
| A: SMILES notation of 5-trimethylsilyldecan-4-one is CCCCCC(C(=O)CCC)[Si](C)(C)C. |
| Q: What is the molecular formula of 5-trimethylsilyldecan-4-one? |
| A: Molecular formula of 5-trimethylsilyldecan-4-one is C13H28OSi. |