(2,4,5-trimethylphenyl)nitromethane
Modify Date: 2025-09-18 18:56:37
(2,4,5-trimethylphenyl)nitromethane structure
|
Common Name | (2,4,5-trimethylphenyl)nitromethane | ||
|---|---|---|---|---|
| CAS Number | 60368-03-8 | Molecular Weight | 179.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,4,5-trimethylphenyl)nitromethane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13NO2 |
|---|---|
| Molecular Weight | 179.21600 |
| Exact Mass | 179.09500 |
| PSA | 45.82000 |
| LogP | 2.91170 |
| InChIKey | PHOUHVCAPAOEBH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C[N+](=O)[O-])cc1C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,5-Trimethylphenylnitromethan |
| 1,2,4-Trimethyl-5-nitromethyl-benzol |
| 2,4,5-Trimethylbenzylnitrat |
| 2,4,5-trimethylphenylnitromethane |
| 1,2,4-trimethyl-5-nitromethyl-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2,4,5-trimethylphenyl)nitromethane? |
| A: LogP of (2,4,5-trimethylphenyl)nitromethane is 2.91170. |
| Q: What is the SMILES notation of (2,4,5-trimethylphenyl)nitromethane? |
| A: SMILES notation of (2,4,5-trimethylphenyl)nitromethane is Cc1cc(C)c(C[N+](=O)[O-])cc1C. |
| Q: What is the molecular formula of (2,4,5-trimethylphenyl)nitromethane? |
| A: Molecular formula of (2,4,5-trimethylphenyl)nitromethane is C10H13NO2. |
| Q: What is the molecular weight of (2,4,5-trimethylphenyl)nitromethane? |
| A: Molecular weight of (2,4,5-trimethylphenyl)nitromethane is 179.21600. |
| Q: What is the Chinese name of 60368-03-8? |
| A: Chinese name of 60368-03-8 is 60368-03-8. |
| Q: What is the English name of (2,4,5-trimethylphenyl)nitromethane? |
| A: The English name of (2,4,5-trimethylphenyl)nitromethane is (2,4,5-trimethylphenyl)nitromethane. |
| Q: What is the polar surface area (PSA) of (2,4,5-trimethylphenyl)nitromethane? |
| A: Polar surface area (PSA) of (2,4,5-trimethylphenyl)nitromethane is 45.82000. |
| Q: What is the CAS number of (2,4,5-trimethylphenyl)nitromethane? |
| A: CAS number of (2,4,5-trimethylphenyl)nitromethane is 60368-03-8. |
| Q: What English synonyms does (2,4,5-trimethylphenyl)nitromethane have? |
| A: English synonyms of (2,4,5-trimethylphenyl)nitromethane: 2,4,5-Trimethylphenylnitromethan, 1,2,4-Trimethyl-5-nitromethyl-benzol, 2,4,5-Trimethylbenzylnitrat, 2,4,5-trimethylphenylnitromethane, 1,2,4-trimethyl-5-nitromethyl-benzene. |
| Q: What is the InChIKey of (2,4,5-trimethylphenyl)nitromethane? |
| A: InChIKey of (2,4,5-trimethylphenyl)nitromethane is PHOUHVCAPAOEBH-UHFFFAOYSA-N. |