2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one structure
|
Common Name | 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 60375-79-3 | Molecular Weight | 256.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6F6O |
|---|---|
| Molecular Weight | 256.14400 |
| Exact Mass | 256.03200 |
| PSA | 17.07000 |
| LogP | 3.40500 |
| InChIKey | DHHCPVXBJFFHRL-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(F)(F)C(F)C(F)(F)F |
|
~%
2,2,3,4,4,4-hex... CAS#:60375-79-3 |
| Literature: Kimoto,H. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1642 - 1649 |
| Phenyl-1,1,2,3,3,3-hexafluorpropyl-keton |
| 1-Butanone,2,2,3,4,4,4-hexafluoro-1-phenyl |