2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one
2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one structure
|
Common Name | 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 60375-79-3 | Molecular Weight | 256.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6F6O |
|---|---|
| Molecular Weight | 256.14400 |
| Exact Mass | 256.03200 |
| PSA | 17.07000 |
| LogP | 3.40500 |
| InChIKey | DHHCPVXBJFFHRL-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(F)(F)C(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,2,3,4,4,4-hex... CAS#:60375-79-3 |
| Literature: Kimoto,H. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1642 - 1649 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phenyl-1,1,2,3,3,3-hexafluorpropyl-keton |
| 1-Butanone,2,2,3,4,4,4-hexafluoro-1-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one have? |
| A: English synonyms of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one: Phenyl-1,1,2,3,3,3-hexafluorpropyl-keton, 1-Butanone,2,2,3,4,4,4-hexafluoro-1-phenyl. |
| Q: What is the SMILES notation of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: SMILES notation of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is O=C(c1ccccc1)C(F)(F)C(F)C(F)(F)F. |
| Q: What is the Chinese name of 60375-79-3? |
| A: Chinese name of 60375-79-3 is 60375-79-3. |
| Q: What is the molecular weight of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: Molecular weight of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is 256.14400. |
| Q: What is the molecular formula of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: Molecular formula of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is C10H6F6O. |
| Q: What is the CAS number of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: CAS number of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is 60375-79-3. |
| Q: What is the polar surface area (PSA) of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: Polar surface area (PSA) of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is 17.07000. |
| Q: What is the English name of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: The English name of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one. |
| Q: What is the LogP of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: LogP of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is 3.40500. |
| Q: What is the InChIKey of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one? |
| A: InChIKey of 2,2,3,4,4,4-hexafluoro-1-phenylbutan-1-one is DHHCPVXBJFFHRL-UHFFFAOYSA-N. |