1-(2-triethylsilyloxyphenyl)ethanone
1-(2-triethylsilyloxyphenyl)ethanone structure
|
Common Name | 1-(2-triethylsilyloxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 60385-50-4 | Molecular Weight | 250.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-triethylsilyloxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22O2Si |
|---|---|
| Molecular Weight | 250.40900 |
| Exact Mass | 250.13900 |
| PSA | 26.30000 |
| LogP | 4.27320 |
| InChIKey | SOWIRQPYMVFOKS-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)Oc1ccccc1C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(2-triethylsi... CAS#:60385-50-4 |
| Literature: Clive; Kellner Tetrahedron Letters, 1991 , vol. 32, # 49 p. 7159 - 7160 |
|
~%
1-(2-triethylsi... CAS#:60385-50-4 |
| Literature: Kusnezowa,I.K. et al. Journal fuer Praktische Chemie (Leipzig), 1976 , vol. 318, p. 413 - 419 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanone,1-[2-[(triethylsilyl)oxy]phenyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: CAS number of 1-(2-triethylsilyloxyphenyl)ethanone is 60385-50-4. |
| Q: What is the LogP of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: LogP of 1-(2-triethylsilyloxyphenyl)ethanone is 4.27320. |
| Q: What is the polar surface area (PSA) of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: Polar surface area (PSA) of 1-(2-triethylsilyloxyphenyl)ethanone is 26.30000. |
| Q: What is the Chinese name of 60385-50-4? |
| A: Chinese name of 60385-50-4 is 60385-50-4. |
| Q: What is the SMILES notation of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: SMILES notation of 1-(2-triethylsilyloxyphenyl)ethanone is CC[Si](CC)(CC)Oc1ccccc1C(C)=O. |
| Q: What is the English name of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: The English name of 1-(2-triethylsilyloxyphenyl)ethanone is 1-(2-triethylsilyloxyphenyl)ethanone. |
| Q: What is the molecular formula of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: Molecular formula of 1-(2-triethylsilyloxyphenyl)ethanone is C14H22O2Si. |
| Q: What is the molecular weight of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: Molecular weight of 1-(2-triethylsilyloxyphenyl)ethanone is 250.40900. |
| Q: What is the InChIKey of 1-(2-triethylsilyloxyphenyl)ethanone? |
| A: InChIKey of 1-(2-triethylsilyloxyphenyl)ethanone is SOWIRQPYMVFOKS-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-(2-triethylsilyloxyphenyl)ethanone have? |
| A: English synonyms of 1-(2-triethylsilyloxyphenyl)ethanone: Ethanone,1-[2-[(triethylsilyl)oxy]phenyl]. |