1,4-Naphthalenedione,2,3,5,7-tetrahydroxy structure
|
Common Name | 1,4-Naphthalenedione,2,3,5,7-tetrahydroxy | ||
|---|---|---|---|---|
| CAS Number | 604-46-6 | Molecular Weight | 222.15100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4,5,7-tetrahydroxynaphthalene-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6O6 |
|---|---|
| Molecular Weight | 222.15100 |
| Exact Mass | 222.01600 |
| PSA | 115.06000 |
| LogP | 0.80440 |
| InChIKey | RWRKDUHFUYRCIT-UHFFFAOYSA-N |
| SMILES | O=C1C(O)=C(O)C(=O)c2c(O)cc(O)cc21 |
|
~%
1,4-Naphthalene... CAS#:604-46-6 |
| Literature: Smith,J.; Thomson,R.H. Journal of the Chemical Society, 1961 , p. 1008 - 1012 |
|
~%
1,4-Naphthalene... CAS#:604-46-6 |
| Literature: Smith,J.; Thomson,R.H. Journal of the Chemical Society, 1961 , p. 1008 - 1012 |
|
~%
1,4-Naphthalene... CAS#:604-46-6 |
| Literature: Smith,J.; Thomson,R.H. Journal of the Chemical Society, 1961 , p. 1008 - 1012 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3,5,7-Tetrahydroxy-1,4-naphthalenedione |
| 2,3,5,7-tetrahydroxy-[1,4]naphthoquinone |
| 2,3,7-Trihydroxy-juglon |
| spinochrome B |
| Spinochrom B |
| SPINOCHROME B (AN) |
| 2,3,5,7-Tetrahydroxy-1,4-naphthochinon |