2,4(1H,3H)-Quinazolinedione,1-methyl structure
|
Common Name | 2,4(1H,3H)-Quinazolinedione,1-methyl | ||
|---|---|---|---|---|
| CAS Number | 604-50-2 | Molecular Weight | 176.17200 | |
| Density | 1.292g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methylquinazoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17200 |
| Exact Mass | 176.05900 |
| PSA | 54.86000 |
| LogP | 0.22680 |
| Index of Refraction | 1.585 |
| InChIKey | RWFOOMQYIRITHL-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c(=O)c2ccccc21 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 1-methyl-2,4-dioxo-1,3-dihydroquinazoline |
| glycosmicine |
| 1,2,3,4-tetrahydro-1-methyl-2,4-dioxoquinazoline |
| 1-methyl-1,3-dihydroquinazoline-2,4-dione |