2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)
Modify Date: 2025-09-22 11:37:20
2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) structure
|
Common Name | 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) | ||
|---|---|---|---|---|
| CAS Number | 604-76-2 | Molecular Weight | 303.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11ClFNO2 |
|---|---|
| Molecular Weight | 303.71 |
| InChIKey | GUIAARNZFVCLIX-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(F)cc2)N(c2cccc(Cl)c2)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)? |
| A: Molecular weight of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) is 303.71. |
| Q: What is the InChIKey of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)? |
| A: InChIKey of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) is GUIAARNZFVCLIX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)? |
| A: Molecular formula of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) is C16H11ClFNO2. |
| Q: What is the English name of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)? |
| A: The English name of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) is 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl). |
| Q: What is the CAS number of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)? |
| A: CAS number of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) is 604-76-2. |
| Q: What is the Chinese name of 604-76-2? |
| A: Chinese name of 604-76-2 is 604-76-2. |
| Q: What is the SMILES notation of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl)? |
| A: SMILES notation of 2,3-Pyrrolidinedione, 1-(3-chlorophenyl)-5-(4-fluorophenyl) is O=C1CC(c2ccc(F)cc2)N(c2cccc(Cl)c2)C1=O. |