4-(2-methylprop-2-enyl)naphthalene-1,2-dione structure
|
Common Name | 4-(2-methylprop-2-enyl)naphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 60404-91-3 | Molecular Weight | 212.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-methylprop-2-enyl)naphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O2 |
|---|---|
| Molecular Weight | 212.24400 |
| Exact Mass | 212.08400 |
| PSA | 34.14000 |
| LogP | 2.80160 |
| InChIKey | ZPPXKPGBQUVOLU-UHFFFAOYSA-N |
| SMILES | C=C(C)CC1=CC(=O)C(=O)c2ccccc21 |
|
~%
4-(2-methylprop... CAS#:60404-91-3 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
|
~%
4-(2-methylprop... CAS#:60404-91-3 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
| 4-(2-methylallyl)-1,2-naphthoquinone |
| 4-(2-methyl-2-propenyl)-1,2-naphthoquinone |
| 1,2-Naphthalenedione,4-(2-methyl-2-propenyl) |
| 4-(2-methyl-prop-2-enyl)-naphthalene-1,2-dione |
| 4-(2-methyl-2-propenyl)-1,2-naphthalenedione |