methyl 3,5-dimethoxy-4-methylbenzoate structure
|
Common Name | methyl 3,5-dimethoxy-4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 60441-79-4 | Molecular Weight | 210.22600 | |
| Density | 1.097g/cm3 | Boiling Point | 303.6ºC at 760 mmHg | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.4ºC | |
| Name | methyl 3,5-dimethoxy-4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 303.6ºC at 760 mmHg |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.22600 |
| Flash Point | 131.4ºC |
| Exact Mass | 210.08900 |
| PSA | 44.76000 |
| LogP | 1.79880 |
| Index of Refraction | 1.498 |
| InChIKey | LEYIAQXZHTVTCH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(C)c(OC)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-dimethoxy-4-methyl-benzoic acid methyl ester |
| methyl 4-methyl-3,5-dimethoxybenzoate |
| 3,5-Dimethoxy-4-methyl-benzoesaeure-methylester |