Piperazine, 1-[(4-methoxyphenyl)sulfonyl]-4-(1-methyl-1H-benzimidazol-2-yl)- (9CI) structure
|
Common Name | Piperazine, 1-[(4-methoxyphenyl)sulfonyl]-4-(1-methyl-1H-benzimidazol-2-yl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 604741-60-8 | Molecular Weight | 386.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-{4-[(4-Methoxyphenyl)sulfonyl]-1-piperazinyl}-1-methyl-1H-benzi midazole |
|---|
| Molecular Formula | C19H22N4O3S |
|---|---|
| Molecular Weight | 386.46800 |
| Exact Mass | 386.14100 |
| PSA | 76.05000 |
| LogP | 3.17650 |
| InChIKey | RCWKVZFGAPBUPI-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3nc4ccccc4n3C)CC2)cc1 |
|
Name: Inhibition of human 11beta-HSD1 expressed in HEK293 cells assessed as [1,2-3H]-cortis...
Source: ChEMBL
Target: 11-beta-hydroxysteroid dehydrogenase 1
External Id: CHEMBL2426862
|
|
Name: Inhibition of human 11beta-HSD2 expressed in HEK293 cells assessed as [1,2,6,7-3H]-co...
Source: ChEMBL
Target: 11-beta-hydroxysteroid dehydrogenase type 2
External Id: CHEMBL2426861
|