4-(carbamoylamino)benzenesulfonic acid structure
|
Common Name | 4-(carbamoylamino)benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6052-44-4 | Molecular Weight | 216.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(carbamoylamino)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8N2O4S |
|---|---|
| Molecular Weight | 216.21400 |
| Exact Mass | 216.02000 |
| PSA | 118.86000 |
| LogP | 2.09150 |
| InChIKey | XJJDJRSMXUUIKJ-UHFFFAOYSA-N |
| SMILES | NC(=O)Nc1ccc(S(=O)(=O)O)cc1 |
|
~%
4-(carbamoylami... CAS#:6052-44-4 |
| Literature: Davis; Blanchard Journal of the American Chemical Society, 1929 , vol. 51, p. 1804 |
|
~%
4-(carbamoylami... CAS#:6052-44-4 |
| Literature: Scott Journal of the Chemical Society, 1923 , vol. 123, p. 3199 |
|
~%
4-(carbamoylami... CAS#:6052-44-4 |
| Literature: Scott Journal of the Chemical Society, 1923 , vol. 123, p. 3199 |
| Benzenesulfonic acid,4-[(aminocarbonyl)amino] |
| N-carbamoyl-sulfanilic acid |
| 4-Ureido-benzol-sulfonsaeure-(1) |
| N-Carbamoyl-sulfanilsaeure |
| (4-Sulfo-phenyl)-harnstoff |