3-(Carboxymethyl)-1,2,4-cyclopentanetricarboxylic Acid 1,4:2,3-Dianhydride structure
|
Common Name | 3-(Carboxymethyl)-1,2,4-cyclopentanetricarboxylic Acid 1,4:2,3-Dianhydride | ||
|---|---|---|---|---|
| CAS Number | 6053-46-9 | Molecular Weight | 224.167 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 517.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C10H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.6±30.2 °C | |
| Name | 4,10-Dioxatricyclo[6.3.1.02,7]dodecane-3,5,9,11-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.5±50.0 °C at 760 mmHg |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.167 |
| Flash Point | 238.6±30.2 °C |
| Exact Mass | 224.032089 |
| PSA | 86.74000 |
| LogP | -2.02 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | QVEIRZNRYOJFCL-UHFFFAOYSA-N |
| SMILES | O=C1CC2C3CC(C(=O)OC3=O)C2C(=O)O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,9-Methano-1H-pyrano[3,4-d]oxepin-1,3,6,8(4H)-tetrone, tetrahydro- |
| 4,10-Dioxatricyclo[6.3.1.0]dodecane-3,5,9,11-tetrone |
| 3-(Carboxymethyl)-1,2,4-cyclopentanetricarboxylic Acid 1,4:2,3-Dianhydride |