trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide
trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide structure
|
Common Name | trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide | ||
|---|---|---|---|---|
| CAS Number | 6054-36-0 | Molecular Weight | 340.09800 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H20Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Trimethyl(3-pyridin-1-ylpropyl)azanium dibromide, CAS number 6054-36-0, molecular formula C11H20Br2N2, molecular weight 340.09800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C11H20Br2N2 |
| Molecular Weight | 340.09800 |
| Exact Mass | 337.99900 |
| PSA | 3.88000 |
| Index of Refraction | 1.69 |
| InChIKey | RKIFMRPSYFQBJG-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCC[n+]1ccccc1.[Br-].[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
trimethyl(3-pyr... CAS#:6054-36-0 |
| Literature: Gray et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3536,3540 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pyridinium,1-(3-(trimethylammonio)propyl)-,dibromide |
| IN 225 |
| Ammonium,(3-pyridiniopropyl)trimethyl-,dibromide |
| 1-(3-(Trimethylammonio)propyl)pyridinium dibromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 6054-36-0? |
| A: Chinese name of 6054-36-0 is 6054-36-0. |
| Q: What is the molecular formula of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: Molecular formula of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is C11H20Br2N2. |
| Q: What is the InChIKey of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: InChIKey of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is RKIFMRPSYFQBJG-UHFFFAOYSA-L. |
| Q: What English synonyms does trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide have? |
| A: English synonyms of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide: Pyridinium,1-(3-(trimethylammonio)propyl)-,dibromide, IN 225, Ammonium,(3-pyridiniopropyl)trimethyl-,dibromide, 1-(3-(Trimethylammonio)propyl)pyridinium dibromide. |
| Q: What is the SMILES notation of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: SMILES notation of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is C[N+](C)(C)CCC[n+]1ccccc1.[Br-].[Br-]. |
| Q: What is the CAS number of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: CAS number of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is 6054-36-0. |
| Q: What is the English name of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: The English name of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide. |
| Q: What is the polar surface area (PSA) of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: Polar surface area (PSA) of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is 3.88000. |
| Q: What is the molecular weight of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide? |
| A: Molecular weight of trimethyl(3-pyridin-1-ium-1-ylpropyl)azanium,dibromide is 340.09800. |