3-pyridyl pinacidil
Modify Date: 2025-11-27 12:44:42
3-pyridyl pinacidil structure
|
Common Name | 3-pyridyl pinacidil | ||
|---|---|---|---|---|
| CAS Number | 60560-07-8 | Molecular Weight | 245.32300 | |
| Density | 1.06g/cm3 | Boiling Point | 356.7ºC at 760 mmHg | |
| Molecular Formula | C13H19N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-pyridin-3-ylguanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 356.7ºC at 760 mmHg |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.32300 |
| Flash Point | 169.5ºC |
| Exact Mass | 245.16400 |
| PSA | 73.10000 |
| LogP | 2.81868 |
| Index of Refraction | 1.552 |
| InChIKey | YJCUMRGFIIKHFP-UHFFFAOYSA-N |
| SMILES | CC(N=C(NC#N)Nc1cccnc1)C(C)(C)C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Cyano-3-(3-pyridyl)-1-(1,2,2-trimethylpropyl)guanidine |
| (-)-N"-cyano-N-3-pyridyl-N'-1,2,2-trimethylpropylguanidine |
| GUANIDINE,2-CYANO-3-(3-PYRIDYL)-1-(1,2,2-TRIMETHYLPROPYL) |
| 3-Pyridyl pinacidil |