2-[(4-methylphenyl)amino]-2-phenyl-acetic acid structure
|
Common Name | 2-[(4-methylphenyl)amino]-2-phenyl-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 60561-72-0 | Molecular Weight | 241.28500 | |
| Density | 1.22g/cm3 | Boiling Point | 419.1ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
| Name | 2-(4-methylanilino)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 419.1ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 207.3ºC |
| Exact Mass | 241.11000 |
| PSA | 49.33000 |
| LogP | 3.30580 |
| Index of Refraction | 1.641 |
| InChIKey | MBFYSIABRBKLNY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(C(=O)O)c2ccccc2)cc1 |
| HS Code | 2922499990 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-methyl-phenyl-amino-phenyl-acetic acid |
| phenyl-p-toluidino-acetic acid |
| HMS1444C08 |
| Phenyl-p-toluidino-essigsaeure |
| (4-methyl-anilino)-phenyl-acetic acid |