1-diethoxyphosphoryl-1-nitroethane
1-diethoxyphosphoryl-1-nitroethane structure
|
Common Name | 1-diethoxyphosphoryl-1-nitroethane | ||
|---|---|---|---|---|
| CAS Number | 60593-26-2 | Molecular Weight | 211.15300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H14NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Diethoxyphosphoryl-1-nitroethane (Chinese name: 1-二乙氧膦酰基-1-硝基乙烷, CAS number: 60593-26-2, molecular formula: C6H14NO5P, molecular weight: 211.15300), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-diethoxyphosphoryl-1-nitroethane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H14NO5P |
|---|---|
| Molecular Weight | 211.15300 |
| Exact Mass | 211.06100 |
| PSA | 91.16000 |
| LogP | 2.39840 |
| InChIKey | QRLMJVRWYNUMLN-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(C)[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-diethoxyphosp... CAS#:60593-26-2 |
| Literature: Green, Donovan; Elgendy, Said; Patel, Geeta; Baban, Jehan A.; Skordalakes, Emmanuel; Husman, Wahid; Kakkar, Vijay V.; Deadman, John Phosphorus, Sulfur and Silicon and Related Elements, 1996 , vol. 113, # 1-4 p. 303 - 306 |
|
~%
1-diethoxyphosp... CAS#:60593-26-2 |
| Literature: Bera, Kalisankar; Namboothiri, Irishi N. N. Organic Letters, 2012 , vol. 14, # 4 p. 980 - 983 |
|
~%
1-diethoxyphosp... CAS#:60593-26-2 |
| Literature: Kandil, Ali A.; Porter, Terence M.; Slessor, Keith N. Synthesis, 1987 , # 4 p. 411 - 413 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| diethyl 1-nitroethylphosphonate |
| Diethyl nitroethanephosphonate |
| (1-nitro-ethyl)-phosphonic acid diethyl ester |
| diethyl 1-(1-nitroethyl)-phosphonate |
| diethyl (1-nitroethan-1-yl)phosphonate |
| Phosphonic acid,(1-nitroethyl)-,diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-diethoxyphosphoryl-1-nitroethane? |
| A: InChIKey of 1-diethoxyphosphoryl-1-nitroethane is QRLMJVRWYNUMLN-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-diethoxyphosphoryl-1-nitroethane? |
| A: Polar surface area (PSA) of 1-diethoxyphosphoryl-1-nitroethane is 91.16000. |
| Q: What English synonyms does 1-diethoxyphosphoryl-1-nitroethane have? |
| A: English synonyms of 1-diethoxyphosphoryl-1-nitroethane: diethyl 1-nitroethylphosphonate, Diethyl nitroethanephosphonate, (1-nitro-ethyl)-phosphonic acid diethyl ester, diethyl 1-(1-nitroethyl)-phosphonate, diethyl (1-nitroethan-1-yl)phosphonate, Phosphonic acid,(1-nitroethyl)-,diethyl ester. |
| Q: What is the molecular formula of 1-diethoxyphosphoryl-1-nitroethane? |
| A: Molecular formula of 1-diethoxyphosphoryl-1-nitroethane is C6H14NO5P. |
| Q: What is the English name of 1-diethoxyphosphoryl-1-nitroethane? |
| A: The English name of 1-diethoxyphosphoryl-1-nitroethane is 1-diethoxyphosphoryl-1-nitroethane. |
| Q: What is the CAS number of 1-diethoxyphosphoryl-1-nitroethane? |
| A: CAS number of 1-diethoxyphosphoryl-1-nitroethane is 60593-26-2. |
| Q: What is the SMILES notation of 1-diethoxyphosphoryl-1-nitroethane? |
| A: SMILES notation of 1-diethoxyphosphoryl-1-nitroethane is CCOP(=O)(OCC)C(C)[N+](=O)[O-]. |
| Q: What is the Chinese name of 60593-26-2? |
| A: Chinese name of 60593-26-2 is 60593-26-2. |
| Q: What is the molecular weight of 1-diethoxyphosphoryl-1-nitroethane? |
| A: Molecular weight of 1-diethoxyphosphoryl-1-nitroethane is 211.15300. |
| Q: What is the LogP of 1-diethoxyphosphoryl-1-nitroethane? |
| A: LogP of 1-diethoxyphosphoryl-1-nitroethane is 2.39840. |