(N-phenylanilino)urea
(N-phenylanilino)urea structure
|
Common Name | (N-phenylanilino)urea | ||
|---|---|---|---|---|
| CAS Number | 606-85-9 | Molecular Weight | 227.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (N-Phenylanilino)urea, Chinese name not provided, CAS number 606-85-9, molecular formula C13H13N3O, molecular weight 227.26200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (N-phenylanilino)urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13N3O |
|---|---|
| Molecular Weight | 227.26200 |
| Exact Mass | 227.10600 |
| PSA | 59.35000 |
| LogP | 3.31270 |
| InChIKey | FDPGUECLKNPLOB-UHFFFAOYSA-N |
| SMILES | NC(=O)NN(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(N-phenylanilin... CAS#:606-85-9 |
| Literature: Michaelis Chemische Berichte, 1908 , vol. 41, p. 1432 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-diphenyl-hydrazinecarboxamide |
| 1,1-diphenyl semicarbazide |
| DIPHENYLSEMICARBAZIDE |
| 1,1-Diphenyl-semicarbazid |
| Hydrazinecarboxamide,2,2-diphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (N-phenylanilino)urea? |
| A: The English name of (N-phenylanilino)urea is (N-phenylanilino)urea. |
| Q: What is the molecular formula of (N-phenylanilino)urea? |
| A: Molecular formula of (N-phenylanilino)urea is C13H13N3O. |
| Q: What is the CAS number of (N-phenylanilino)urea? |
| A: CAS number of (N-phenylanilino)urea is 606-85-9. |
| Q: What is the SMILES notation of (N-phenylanilino)urea? |
| A: SMILES notation of (N-phenylanilino)urea is NC(=O)NN(c1ccccc1)c1ccccc1. |
| Q: What is the LogP of (N-phenylanilino)urea? |
| A: LogP of (N-phenylanilino)urea is 3.31270. |
| Q: What English synonyms does (N-phenylanilino)urea have? |
| A: English synonyms of (N-phenylanilino)urea: 2,2-diphenyl-hydrazinecarboxamide, 1,1-diphenyl semicarbazide, DIPHENYLSEMICARBAZIDE, 1,1-Diphenyl-semicarbazid, Hydrazinecarboxamide,2,2-diphenyl. |
| Q: What is the Chinese name of 606-85-9? |
| A: Chinese name of 606-85-9 is 606-85-9. |
| Q: What is the InChIKey of (N-phenylanilino)urea? |
| A: InChIKey of (N-phenylanilino)urea is FDPGUECLKNPLOB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (N-phenylanilino)urea? |
| A: Molecular weight of (N-phenylanilino)urea is 227.26200. |
| Q: What is the polar surface area (PSA) of (N-phenylanilino)urea? |
| A: Polar surface area (PSA) of (N-phenylanilino)urea is 59.35000. |