4-[[(3S,5R,8R,9S,10S,13R,14S)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxo-butanoic acid structure
|
Common Name | 4-[[(3S,5R,8R,9S,10S,13R,14S)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-oxo-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 60617-83-6 | Molecular Weight | 486.59700 | |
| Density | 1.27g/cm3 | Boiling Point | 664.2ºC at 760 mmHg | |
| Molecular Formula | C28H38O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | Bufalin, 3-hemisuccinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 664.2ºC at 760 mmHg |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.59700 |
| Flash Point | 218.1ºC |
| Exact Mass | 486.26200 |
| PSA | 114.04000 |
| LogP | 4.65760 |
| Index of Refraction | 1.586 |
| InChIKey | OYIGRQUNGJYTTR-FMOATVMESA-N |
| SMILES | CC12CCC(OC(=O)CCC(=O)O)CC1CCC1C2CCC2(C)C(c3ccc(=O)oc3)CCC12O |
|
~%
4-[[(3S,5R,8R,9... CAS#:60617-83-6 |
| Literature: Kamano, Yoshiaki; Kotake, Ayano; Hashima, Hirofumi; Inoue, Masuo; Morita, Hiroshi; Takeya, Koichi; Itokawa, Hideji; Nandachi, Nobuyo; Segawa, Toshiaki; Yukita, Ayako; Saitou, Kyoko; Katsuyama, Mariko; Pettit, George R. Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 7 p. 1103 - 1115 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bufalin 3-succinate |
| 3-O-succinylbufalin |